C16H26Cl2N2O3 — CID 142024906
N-(3,5-dichlorophenyl)-3-(methylamino)-5-oxopentanamide;methanol;propane (PubChem CID 142024906) has the molecular formula C16H26Cl2N2O3 and a molecular weight of 365.30 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-3-(methylamino)-5-oxopentanamide;methanol;propane.
| Compound Name | N-(3,5-dichlorophenyl)-3-(methylamino)-5-oxopentanamide;methanol;propane |
|---|---|
| PubChem CID | 142024906 |
| Molecular Formula | C16H26Cl2N2O3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-(3,5-dichlorophenyl)-3-(methylamino)-5-oxopentanamide;methanol;propane |
| SMILES | CCC.CNC(CC=O)CC(=O)Nc1cc(Cl)cc(Cl)c1.CO |
| InChI | InChI=1S/C12H14Cl2N2O2.C3H8.CH4O/c1-15-10(2-3-17)7-12(18)16-11-5-8(13)4-9(14)6-11;1-3-2;1-2/h3-6,10,15H,2,7H2,1H3,(H,16,18);3H2,1-2H3;2H,1H3 |
| InChIKey | XIMQGOMIXZLRMO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|