C11H17NO — CID 142028571
(3R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]pyrrolidine (PubChem CID 142028571) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]pyrrolidine.
| Compound Name | (3R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]pyrrolidine |
|---|---|
| PubChem CID | 142028571 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]pyrrolidine |
| SMILES | C=C/C=C(\C=C)CO[C@@H]1CCNC1 |
| InChI | InChI=1S/C11H17NO/c1-3-5-10(4-2)9-13-11-6-7-12-8-11/h3-5,11-12H,1-2,6-9H2/b10-5+/t11-/m1/s1 |
| InChIKey | KQEFADPUTVGJNI-IGLBNKAOSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|