C17H21NO5 — CID 142034622
ethyl 7-(2-methoxyethoxy)-1,4-dimethyl-2-oxoquinoline-6-carboxylate (PubChem CID 142034622) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 7-(2-methoxyethoxy)-1,4-dimethyl-2-oxoquinoline-6-carboxylate.
| Compound Name | ethyl 7-(2-methoxyethoxy)-1,4-dimethyl-2-oxoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 142034622 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 7-(2-methoxyethoxy)-1,4-dimethyl-2-oxoquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(C)cc(=O)n(C)c2cc1OCCOC |
| InChI | InChI=1S/C17H21NO5/c1-5-22-17(20)13-9-12-11(2)8-16(19)18(3)14(12)10-15(13)23-7-6-21-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | GYTIVUCVLAVYIR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|