C22H35N7O4 — CID 142039067
N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanamide (PubChem CID 142039067) has the molecular formula C22H35N7O4 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanamide |
|---|---|
| PubChem CID | 142039067 |
| Molecular Formula | C22H35N7O4 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanamide |
| SMILES | [H]/N=C(C)/C(CNc1nccn(C(CC)C(=O)NCC(=O)CN(C)C2CCCCC2)c1=O)=N\O |
| InChI | InChI=1S/C22H35N7O4/c1-4-19(21(31)26-12-17(30)14-28(3)16-8-6-5-7-9-16)29-11-10-24-20(22(29)32)25-13-18(27-33)15(2)23/h10-11,16,19,23,33H,4-9,12-14H2,1-3H3,(H,24,25)(H,26,31)/b23-15+,27-18- |
| InChIKey | CVNOPODOOSNPQR-SPOPVUIMSA-N |
| XLogP | 1.43 |
| TPSA | 152.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|