C20H35NO — CID 142041462
ethane;(1E,3E)-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-1-amine (PubChem CID 142041462) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is ethane;(1E,3E)-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-1-amine.
| Compound Name | ethane;(1E,3E)-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 142041462 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | ethane;(1E,3E)-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/C)C(=C\N)/COC(/C=C\C)=C/C.CC.CC |
| InChI | InChI=1S/C16H23NO.2C2H6/c1-5-9-14(10-6-2)15(12-17)13-18-16(8-4)11-7-3;2*1-2/h5-12H,1,13,17H2,2-4H3;2*1-2H3/b10-6-,11-7-,14-9+,15-12-,16-8+;; |
| InChIKey | INKFUAOZIWKYHL-GFVCOUMWSA-N |
| XLogP | 6.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|