C18H37N2O5P — CID 142050053
6-amino-2-[[[1-(heptanoylamino)-2-methylpropyl]-hydroxyphosphoryl]methyl]hexanoic acid (PubChem CID 142050053) has the molecular formula C18H37N2O5P and a molecular weight of 392.48 g/mol. Its IUPAC name is 6-amino-2-[[[1-(heptanoylamino)-2-methylpropyl]-hydroxyphosphoryl]methyl]hexanoic acid.
| Compound Name | 6-amino-2-[[[1-(heptanoylamino)-2-methylpropyl]-hydroxyphosphoryl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 142050053 |
| Molecular Formula | C18H37N2O5P |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 6-amino-2-[[[1-(heptanoylamino)-2-methylpropyl]-hydroxyphosphoryl]methyl]hexanoic acid |
| SMILES | CCCCCCC(=O)NC(C(C)C)P(=O)(O)CC(CCCCN)C(=O)O |
| InChI | InChI=1S/C18H37N2O5P/c1-4-5-6-7-11-16(21)20-17(14(2)3)26(24,25)13-15(18(22)23)10-8-9-12-19/h14-15,17H,4-13,19H2,1-3H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | VQDVQMKNWJOGAQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|