C9H15NO2 — CID 142053027
(3,5-dimethoxycyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 142053027) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3,5-dimethoxycyclohexa-1,3-dien-1-yl)methanamine.
| Compound Name | (3,5-dimethoxycyclohexa-1,3-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 142053027 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3,5-dimethoxycyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | COC1=CC(OC)CC(CN)=C1 |
| InChI | InChI=1S/C9H15NO2/c1-11-8-3-7(6-10)4-9(5-8)12-2/h3,5,9H,4,6,10H2,1-2H3 |
| InChIKey | CWXSGFORKMAQJS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |