C10H17NO3 — CID 123239183
(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 123239183) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)methanamine.
| Compound Name | (3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 123239183 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | COC1=C(OC)C(OC)CC(CN)=C1 |
| InChI | InChI=1S/C10H17NO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4,9H,5-6,11H2,1-3H3 |
| InChIKey | QHPGZKCYLLVSLK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |