C7H6N2O2S — CID 142054366
1-methylthieno[3,4-d]pyrimidine-2,4-dione (PubChem CID 142054366) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is 1-methylthieno[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 1-methylthieno[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142054366 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 1-methylthieno[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2cscc21 |
| InChI | InChI=1S/C7H6N2O2S/c1-9-5-3-12-2-4(5)6(10)8-7(9)11/h2-3H,1H3,(H,8,10,11) |
| InChIKey | AEKCIRZIQCYJTQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |