C38H55NO7Si — CID 142058980
ditert-butyl (2R,4S,5R)-5-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypropanoyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 142058980) has the molecular formula C38H55NO7Si and a molecular weight of 665.94 g/mol. Its IUPAC name is ditert-butyl (2R,4S,5R)-5-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypropanoyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4S,5R)-5-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypropanoyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142058980 |
| Molecular Formula | C38H55NO7Si |
| Molecular Weight | 665.94 g/mol |
| Exact Mass | 665.37 |
| IUPAC Name | ditert-butyl (2R,4S,5R)-5-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypropanoyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1C(=O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC |
| InChI | InChI=1S/C38H55NO7Si/c1-12-20-27-25-30(34(41)45-36(3,4)5)39(35(42)46-37(6,7)8)32(27)33(40)31(43-13-2)26-44-47(38(9,10)11,28-21-16-14-17-22-28)29-23-18-15-19-24-29/h12,14-24,27,30-32H,13,25-26H2,1-11H3/b20-12-/t27-,30-,31+,32-/m1/s1 |
| InChIKey | XHHCAEROODVWJU-LCSHNKFASA-N |
| XLogP | 6.45 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.94 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|