C30H41NO5Si — CID 91229958
tert-butyl (2S,3R,5R)-5-acetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(oxiran-2-yl)pyrrolidine-1-carboxylate (PubChem CID 91229958) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is tert-butyl (2S,3R,5R)-5-acetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(oxiran-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,5R)-5-acetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(oxiran-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91229958 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | tert-butyl (2S,3R,5R)-5-acetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(oxiran-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)[C@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C2CO2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41NO5Si/c1-21(32)25-18-22(27(26-20-34-26)31(25)28(33)36-29(2,3)4)19-35-37(30(5,6)7,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,22,25-27H,18-20H2,1-7H3/t22-,25+,26?,27-/m0/s1 |
| InChIKey | DSEWJXFNLKSGPF-OBSOVGLUSA-N |
| XLogP | 4.55 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|