C8H11ClF4 — CID 142059049
(Z)-3-chloro-1,1,1,2-tetrafluoro-5-methylhept-2-ene (PubChem CID 142059049) has the molecular formula C8H11ClF4 and a molecular weight of 218.62 g/mol. Its IUPAC name is (Z)-3-chloro-1,1,1,2-tetrafluoro-5-methylhept-2-ene.
| Compound Name | (Z)-3-chloro-1,1,1,2-tetrafluoro-5-methylhept-2-ene |
|---|---|
| PubChem CID | 142059049 |
| Molecular Formula | C8H11ClF4 |
| Molecular Weight | 218.62 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (Z)-3-chloro-1,1,1,2-tetrafluoro-5-methylhept-2-ene |
| SMILES | CCC(C)C/C(Cl)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C8H11ClF4/c1-3-5(2)4-6(9)7(10)8(11,12)13/h5H,3-4H2,1-2H3/b7-6- |
| InChIKey | GZFWWCMNTQYFBD-SREVYHEPSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |