C26H30BrF4N3O3 — CID 142060163
tert-butyl N-[[3-[4-[(4-bromo-2-fluorophenyl)carbamoyl]-7,7,7-trifluoro-6-iminoheptyl]phenyl]methyl]carbamate (PubChem CID 142060163) has the molecular formula C26H30BrF4N3O3 and a molecular weight of 588.44 g/mol. Its IUPAC name is tert-butyl N-[[3-[4-[(4-bromo-2-fluorophenyl)carbamoyl]-7,7,7-trifluoro-6-iminoheptyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[4-[(4-bromo-2-fluorophenyl)carbamoyl]-7,7,7-trifluoro-6-iminoheptyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142060163 |
| Molecular Formula | C26H30BrF4N3O3 |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | tert-butyl N-[[3-[4-[(4-bromo-2-fluorophenyl)carbamoyl]-7,7,7-trifluoro-6-iminoheptyl]phenyl]methyl]carbamate |
| SMILES | [H]/N=C(/CC(CCCc1cccc(CNC(=O)OC(C)(C)C)c1)C(=O)Nc1ccc(Br)cc1F)C(F)(F)F |
| InChI | InChI=1S/C26H30BrF4N3O3/c1-25(2,3)37-24(36)33-15-17-8-4-6-16(12-17)7-5-9-18(13-22(32)26(29,30)31)23(35)34-21-11-10-19(27)14-20(21)28/h4,6,8,10-12,14,18,32H,5,7,9,13,15H2,1-3H3,(H,33,36)(H,34,35)/b32-22- |
| InChIKey | FEWZPXWPQARNRA-JDCMOKTRSA-N |
| XLogP | 7.16 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|