C23H25O3P — CID 142060293
6-[3-tert-butyl-4-(methylphosphanylmethoxy)phenyl]naphthalene-2-carboxylic acid (PubChem CID 142060293) has the molecular formula C23H25O3P and a molecular weight of 380.42 g/mol. Its IUPAC name is 6-[3-tert-butyl-4-(methylphosphanylmethoxy)phenyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[3-tert-butyl-4-(methylphosphanylmethoxy)phenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 142060293 |
| Molecular Formula | C23H25O3P |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 6-[3-tert-butyl-4-(methylphosphanylmethoxy)phenyl]naphthalene-2-carboxylic acid |
| SMILES | CPCOc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C(C)(C)C |
| InChI | InChI=1S/C23H25O3P/c1-23(2,3)20-13-18(9-10-21(20)26-14-27-4)16-5-6-17-12-19(22(24)25)8-7-15(17)11-16/h5-13,27H,14H2,1-4H3,(H,24,25) |
| InChIKey | FHHRIUCJSQOBFP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|