C15H25N3W — CID 142064434
1-[[(2Z)-4-ethyl-2-hydrazinylidene-3-[(Z)-prop-1-enyl]cyclohept-3-en-1-yl]amino]propylidenetungsten (PubChem CID 142064434) has the molecular formula C15H25N3W and a molecular weight of 431.23 g/mol. Its IUPAC name is 1-[[(2Z)-4-ethyl-2-hydrazinylidene-3-[(Z)-prop-1-enyl]cyclohept-3-en-1-yl]amino]propylidenetungsten.
| Compound Name | 1-[[(2Z)-4-ethyl-2-hydrazinylidene-3-[(Z)-prop-1-enyl]cyclohept-3-en-1-yl]amino]propylidenetungsten |
|---|---|
| PubChem CID | 142064434 |
| Molecular Formula | C15H25N3W |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[[(2Z)-4-ethyl-2-hydrazinylidene-3-[(Z)-prop-1-enyl]cyclohept-3-en-1-yl]amino]propylidenetungsten |
| SMILES | C/C=C\C1=C(CC)CCCC(NC(=[W])CC)/C1=N\N |
| InChI | InChI=1S/C15H25N3.W/c1-4-8-13-12(6-3)9-7-10-14(15(13)18-16)17-11-5-2;/h4,8,14,17H,5-7,9-10,16H2,1-3H3;/b8-4-,18-15-; |
| InChIKey | XPWMUXKKMKCXJU-POQZXBKCSA-N |
| XLogP | 2.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|