About methanol;2-methoxy-6-methyloxane-4-carbonyl azide
methanol;2-methoxy-6-methyloxane-4-carbonyl azide (PubChem CID 142065024) has the molecular formula C9H17N3O4
and a molecular weight of 231.25 g/mol. Its IUPAC name is methanol;2-methoxy-6-methyloxane-4-carbonyl azide.
Molecular Properties
| Compound Name | methanol;2-methoxy-6-methyloxane-4-carbonyl azide |
| PubChem CID | 142065024 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | methanol;2-methoxy-6-methyloxane-4-carbonyl azide |
| SMILES | CO.COC1CC(C(=O)N=[N+]=[N-])CC(C)O1 |
| InChI | InChI=1S/C8H13N3O3.CH4O/c1-5-3-6(8(12)10-11-9)4-7(13-2)14-5;1-2/h5-7H,3-4H2,1-2H3;2H,1H3 |
| InChIKey | MJXYQYHNDCIOCS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-methoxy-6-methyloxane-4-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methoxy-6-methyloxane-4-carbonyl azide?
The IUPAC name of methanol;2-methoxy-6-methyloxane-4-carbonyl azide (CID 142065024) is methanol;2-methoxy-6-methyloxane-4-carbonyl azide.
What is the SMILES notation for methanol;2-methoxy-6-methyloxane-4-carbonyl azide?
The canonical SMILES for methanol;2-methoxy-6-methyloxane-4-carbonyl azide is CO.COC1CC(C(=O)N=[N+]=[N-])CC(C)O1.
What is the InChIKey of methanol;2-methoxy-6-methyloxane-4-carbonyl azide?
The InChIKey is MJXYQYHNDCIOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3.CH4O/c1-5-3-6(8(12)10-11-9)4-7(13-2)14-5;1-2/h5-7H,3-4H2,1-2H3;2H,1H3.
What are the key properties of methanol;2-methoxy-6-methyloxane-4-carbonyl azide?
methanol;2-methoxy-6-methyloxane-4-carbonyl azide has a molecular weight of 231.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methoxy-6-methyloxane-4-carbonyl azide is sourced from PubChem (CID 142065024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).