C14H23N — CID 142069170
6-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 142069170) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 6-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 6-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 142069170 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 6-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | C=C(C)/C=C\C1=CCCN(C(C)C)C1C |
| InChI | InChI=1S/C14H23N/c1-11(2)8-9-14-7-6-10-15(12(3)4)13(14)5/h7-9,12-13H,1,6,10H2,2-5H3/b9-8- |
| InChIKey | HPELFERNMMFHIW-HJWRWDBZSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|