C21H22F6N2O2 — CID 142070475
N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(methylamino)-2-(4-methylphenyl)propyl]formamide (PubChem CID 142070475) has the molecular formula C21H22F6N2O2 and a molecular weight of 448.41 g/mol. Its IUPAC name is N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(methylamino)-2-(4-methylphenyl)propyl]formamide.
| Compound Name | N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(methylamino)-2-(4-methylphenyl)propyl]formamide |
|---|---|
| PubChem CID | 142070475 |
| Molecular Formula | C21H22F6N2O2 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(methylamino)-2-(4-methylphenyl)propyl]formamide |
| SMILES | CNC(CNC=O)(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22F6N2O2/c1-14-3-5-16(6-4-14)19(28-2,11-29-13-30)12-31-10-15-7-17(20(22,23)24)9-18(8-15)21(25,26)27/h3-9,13,28H,10-12H2,1-2H3,(H,29,30) |
| InChIKey | BUTAENRONCAWDL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|