C5H6N2O5 — CID 142071577
(3-nitro-4,5-dihydro-1,2-oxazol-4-yl) acetate (PubChem CID 142071577) has the molecular formula C5H6N2O5 and a molecular weight of 174.11 g/mol. Its IUPAC name is (3-nitro-4,5-dihydro-1,2-oxazol-4-yl) acetate.
| Compound Name | (3-nitro-4,5-dihydro-1,2-oxazol-4-yl) acetate |
|---|---|
| PubChem CID | 142071577 |
| Molecular Formula | C5H6N2O5 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (3-nitro-4,5-dihydro-1,2-oxazol-4-yl) acetate |
| SMILES | CC(=O)OC1CON=C1[N+](=O)[O-] |
| InChI | InChI=1S/C5H6N2O5/c1-3(8)12-4-2-11-6-5(4)7(9)10/h4H,2H2,1H3 |
| InChIKey | SUNPUVLVVDUCJR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|