C7H9NO5 — CID 14663810
(4-nitro-3,6-dihydro-2H-pyran-3-yl) acetate (PubChem CID 14663810) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is (4-nitro-3,6-dihydro-2H-pyran-3-yl) acetate.
| Compound Name | (4-nitro-3,6-dihydro-2H-pyran-3-yl) acetate |
|---|---|
| PubChem CID | 14663810 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (4-nitro-3,6-dihydro-2H-pyran-3-yl) acetate |
| SMILES | CC(=O)OC1COCC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9NO5/c1-5(9)13-7-4-12-3-2-6(7)8(10)11/h2,7H,3-4H2,1H3 |
| InChIKey | PCOCBPDRNYRLLQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|