C15H15NO7 — CID 102224419
[(4aR,8R,8aS)-7-nitro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102224419) has the molecular formula C15H15NO7 and a molecular weight of 321.29 g/mol. Its IUPAC name is [(4aR,8R,8aS)-7-nitro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,8R,8aS)-7-nitro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102224419 |
| Molecular Formula | C15H15NO7 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [(4aR,8R,8aS)-7-nitro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C([N+](=O)[O-])=CO[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C15H15NO7/c1-9(17)22-13-11(16(18)19)7-20-12-8-21-15(23-14(12)13)10-5-3-2-4-6-10/h2-7,12-15H,8H2,1H3/t12-,13-,14-,15?/m1/s1 |
| InChIKey | FTOJJTOITJLGLO-CBNXCZCTSA-N |
| XLogP | 1.55 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|