C26H29N3O6 — CID 142073349
(2-methoxy-1-methylcyclohex-3-en-1-yl)methyl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]carbamate (PubChem CID 142073349) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (2-methoxy-1-methylcyclohex-3-en-1-yl)methyl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]carbamate.
| Compound Name | (2-methoxy-1-methylcyclohex-3-en-1-yl)methyl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]carbamate |
|---|---|
| PubChem CID | 142073349 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (2-methoxy-1-methylcyclohex-3-en-1-yl)methyl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]carbamate |
| SMILES | COc1cc2ncnc(Oc3ccc(NC(=O)OCC4(C)CCC=CC4OC)cc3)c2cc1OC |
| InChI | InChI=1S/C26H29N3O6/c1-26(12-6-5-7-23(26)33-4)15-34-25(30)29-17-8-10-18(11-9-17)35-24-19-13-21(31-2)22(32-3)14-20(19)27-16-28-24/h5,7-11,13-14,16,23H,6,12,15H2,1-4H3,(H,29,30) |
| InChIKey | FNEFTXDYRPUVQS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|