C24H26N4O4S — CID 142073455
N-[[4-(6-hydroxy-7-methoxyquinazolin-4-yl)oxyphenyl]carbamothioyl]-1-methylcyclohexane-1-carboxamide (PubChem CID 142073455) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[[4-(6-hydroxy-7-methoxyquinazolin-4-yl)oxyphenyl]carbamothioyl]-1-methylcyclohexane-1-carboxamide.
| Compound Name | N-[[4-(6-hydroxy-7-methoxyquinazolin-4-yl)oxyphenyl]carbamothioyl]-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142073455 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[[4-(6-hydroxy-7-methoxyquinazolin-4-yl)oxyphenyl]carbamothioyl]-1-methylcyclohexane-1-carboxamide |
| SMILES | COc1cc2ncnc(Oc3ccc(NC(=S)NC(=O)C4(C)CCCCC4)cc3)c2cc1O |
| InChI | InChI=1S/C24H26N4O4S/c1-24(10-4-3-5-11-24)22(30)28-23(33)27-15-6-8-16(9-7-15)32-21-17-12-19(29)20(31-2)13-18(17)25-14-26-21/h6-9,12-14,29H,3-5,10-11H2,1-2H3,(H2,27,28,30,33) |
| InChIKey | SLQYJQOUTHIQFN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|