C24H34ClNS — CID 142073367
(E)-4-[4-[(Z,4E)-4-(1-chloroethylidene)oct-5-enyl]sulfanylphenyl]-N,3-dimethylbut-2-en-1-imine;ethene (PubChem CID 142073367) has the molecular formula C24H34ClNS and a molecular weight of 404.06 g/mol. Its IUPAC name is (E)-4-[4-[(Z,4E)-4-(1-chloroethylidene)oct-5-enyl]sulfanylphenyl]-N,3-dimethylbut-2-en-1-imine;ethene.
| Compound Name | (E)-4-[4-[(Z,4E)-4-(1-chloroethylidene)oct-5-enyl]sulfanylphenyl]-N,3-dimethylbut-2-en-1-imine;ethene |
|---|---|
| PubChem CID | 142073367 |
| Molecular Formula | C24H34ClNS |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (E)-4-[4-[(Z,4E)-4-(1-chloroethylidene)oct-5-enyl]sulfanylphenyl]-N,3-dimethylbut-2-en-1-imine;ethene |
| SMILES | C=C.CC/C=C\C(CCCSc1ccc(C/C(C)=C/C=N/C)cc1)=C(/C)Cl |
| InChI | InChI=1S/C22H30ClNS.C2H4/c1-5-6-8-21(19(3)23)9-7-16-25-22-12-10-20(11-13-22)17-18(2)14-15-24-4;1-2/h6,8,10-15H,5,7,9,16-17H2,1-4H3;1-2H2/b8-6-,18-14+,21-19-,24-15+; |
| InChIKey | UKGHLBVONGULJW-DHZHUNIISA-N |
| XLogP | 8.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|