C19H16F3N5O6S — CID 142074757
[1-nitrooxy-3-[[4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfanylamino]propan-2-yl] nitrate (PubChem CID 142074757) has the molecular formula C19H16F3N5O6S and a molecular weight of 499.43 g/mol. Its IUPAC name is [1-nitrooxy-3-[[4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfanylamino]propan-2-yl] nitrate.
| Compound Name | [1-nitrooxy-3-[[4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfanylamino]propan-2-yl] nitrate |
|---|---|
| PubChem CID | 142074757 |
| Molecular Formula | C19H16F3N5O6S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | [1-nitrooxy-3-[[4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfanylamino]propan-2-yl] nitrate |
| SMILES | O=[N+]([O-])OCC(CNSc1ccc(-n2nc(C(F)(F)F)cc2-c2ccccc2)cc1)O[N+](=O)[O-] |
| InChI | InChI=1S/C19H16F3N5O6S/c20-19(21,22)18-10-17(13-4-2-1-3-5-13)25(24-18)14-6-8-16(9-7-14)34-23-11-15(33-27(30)31)12-32-26(28)29/h1-10,15,23H,11-12H2 |
| InChIKey | OXFSKODKWLAGDR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|