C17H34N2 — CID 142075739
ethane;1-ethenyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazine;propane (PubChem CID 142075739) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;1-ethenyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazine;propane.
| Compound Name | ethane;1-ethenyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazine;propane |
|---|---|
| PubChem CID | 142075739 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | ethane;1-ethenyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazine;propane |
| SMILES | C=CN1CCNCC1C(/C=C\C)=C/C.CC.CCC |
| InChI | InChI=1S/C12H20N2.C3H8.C2H6/c1-4-7-11(5-2)12-10-13-8-9-14(12)6-3;1-3-2;1-2/h4-7,12-13H,3,8-10H2,1-2H3;3H2,1-2H3;1-2H3/b7-4-,11-5+;; |
| InChIKey | QLEQKCRFMHAQKW-SXBOFFEESA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|