C14H32N2 — CID 142076932
ethane;(1Z,3Z)-2-methylpenta-1,3-dien-1-amine;2-methylpentan-1-amine (PubChem CID 142076932) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;(1Z,3Z)-2-methylpenta-1,3-dien-1-amine;2-methylpentan-1-amine.
| Compound Name | ethane;(1Z,3Z)-2-methylpenta-1,3-dien-1-amine;2-methylpentan-1-amine |
|---|---|
| PubChem CID | 142076932 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | ethane;(1Z,3Z)-2-methylpenta-1,3-dien-1-amine;2-methylpentan-1-amine |
| SMILES | C/C=C\C(C)=C/N.CC.CCCC(C)CN |
| InChI | InChI=1S/C6H15N.C6H11N.C2H6/c2*1-3-4-6(2)5-7;1-2/h6H,3-5,7H2,1-2H3;3-5H,7H2,1-2H3;1-2H3/b;4-3-,6-5-; |
| InChIKey | PVDWFPGWWFPMDD-SAXVSKPSSA-N |
| XLogP | 3.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|