C10H21N — CID 145443397
(1Z,3Z)-2,5-dimethylhexa-1,3-dien-1-amine;ethane (PubChem CID 145443397) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is (1Z,3Z)-2,5-dimethylhexa-1,3-dien-1-amine;ethane.
| Compound Name | (1Z,3Z)-2,5-dimethylhexa-1,3-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145443397 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (1Z,3Z)-2,5-dimethylhexa-1,3-dien-1-amine;ethane |
| SMILES | CC.CC(/C=C\C(C)C)=C/N |
| InChI | InChI=1S/C8H15N.C2H6/c1-7(2)4-5-8(3)6-9;1-2/h4-7H,9H2,1-3H3;1-2H3/b5-4-,8-6-; |
| InChIKey | YUBGQWBFHSTBAE-PRWWQMKWSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|