About butane;butyl-methyl-(2-methylphenyl)borane
butane;butyl-methyl-(2-methylphenyl)borane (PubChem CID 142078381) has the molecular formula C16H29B
and a molecular weight of 232.22 g/mol. Its IUPAC name is butane;butyl-methyl-(2-methylphenyl)borane.
Molecular Properties
| Compound Name | butane;butyl-methyl-(2-methylphenyl)borane |
| PubChem CID | 142078381 |
| Molecular Formula | C16H29B |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | butane;butyl-methyl-(2-methylphenyl)borane |
| SMILES | CCCC.CCCCB(C)c1ccccc1C |
| InChI | InChI=1S/C12H19B.C4H10/c1-4-5-10-13(3)12-9-7-6-8-11(12)2;1-3-4-2/h6-9H,4-5,10H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | LHVCSSSHLVQWKY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butane;butyl-methyl-(2-methylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;butyl-methyl-(2-methylphenyl)borane?
The IUPAC name of butane;butyl-methyl-(2-methylphenyl)borane (CID 142078381) is butane;butyl-methyl-(2-methylphenyl)borane.
What is the SMILES notation for butane;butyl-methyl-(2-methylphenyl)borane?
The canonical SMILES for butane;butyl-methyl-(2-methylphenyl)borane is CCCC.CCCCB(C)c1ccccc1C.
What is the InChIKey of butane;butyl-methyl-(2-methylphenyl)borane?
The InChIKey is LHVCSSSHLVQWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19B.C4H10/c1-4-5-10-13(3)12-9-7-6-8-11(12)2;1-3-4-2/h6-9H,4-5,10H2,1-3H3;3-4H2,1-2H3.
What are the key properties of butane;butyl-methyl-(2-methylphenyl)borane?
butane;butyl-methyl-(2-methylphenyl)borane has a molecular weight of 232.22 g/mol, XLogP of 4.93, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;butyl-methyl-(2-methylphenyl)borane is sourced from PubChem (CID 142078381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).