C12H15N3 — CID 142081957
3-buta-1,3-dien-2-yl-N-methyl-1,5-dihydropyrrolo[2,3-c]pyridin-6-amine (PubChem CID 142081957) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-N-methyl-1,5-dihydropyrrolo[2,3-c]pyridin-6-amine.
| Compound Name | 3-buta-1,3-dien-2-yl-N-methyl-1,5-dihydropyrrolo[2,3-c]pyridin-6-amine |
|---|---|
| PubChem CID | 142081957 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-N-methyl-1,5-dihydropyrrolo[2,3-c]pyridin-6-amine |
| SMILES | C=CC(=C)c1c[nH]c2c1=CCN(NC)C=2 |
| InChI | InChI=1S/C12H15N3/c1-4-9(2)11-7-14-12-8-15(13-3)6-5-10(11)12/h4-5,7-8,13-14H,1-2,6H2,3H3 |
| InChIKey | ZYGLJUVAGGENJX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|