C42H52 — CID 142083821
methane;1-methyl-2-[(1Z,4Z)-3,3,6-trimethylhepta-1,4-dienyl]naphthalene;5,5,14,14-tetramethyltricyclo[9.5.0.02,8]hexadeca-1(11),2(8),3,6,9,12,15-heptaene (PubChem CID 142083821) has the molecular formula C42H52 and a molecular weight of 556.88 g/mol. Its IUPAC name is methane;1-methyl-2-[(1Z,4Z)-3,3,6-trimethylhepta-1,4-dienyl]naphthalene;5,5,14,14-tetramethyltricyclo[9.5.0.02,8]hexadeca-1(11),2(8),3,6,9,12,15-heptaene.
| Compound Name | methane;1-methyl-2-[(1Z,4Z)-3,3,6-trimethylhepta-1,4-dienyl]naphthalene;5,5,14,14-tetramethyltricyclo[9.5.0.02,8]hexadeca-1(11),2(8),3,6,9,12,15-heptaene |
|---|---|
| PubChem CID | 142083821 |
| Molecular Formula | C42H52 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | methane;1-methyl-2-[(1Z,4Z)-3,3,6-trimethylhepta-1,4-dienyl]naphthalene;5,5,14,14-tetramethyltricyclo[9.5.0.02,8]hexadeca-1(11),2(8),3,6,9,12,15-heptaene |
| SMILES | C.CC1(C)C=Cc2ccc3c(c2C=C1)C=CC(C)(C)C=C3.Cc1c(/C=C\C(C)(C)/C=C\C(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C21H26.C20H22.CH4/c1-16(2)12-14-21(4,5)15-13-18-10-11-19-8-6-7-9-20(19)17(18)3;1-19(2)11-7-15-5-6-16-8-12-20(3,4)14-10-18(16)17(15)9-13-19;/h6-16H,1-5H3;5-14H,1-4H3;1H4/b14-12-,15-13-;; |
| InChIKey | VXELEJZDIZEJJD-RQMLOHAESA-N |
| XLogP | 12.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|