C19H15ClO3S — CID 142087805
5-chloro-2,8-dimethoxy-10-sulfanyloxy-11H-benzo[b]fluorene (PubChem CID 142087805) has the molecular formula C19H15ClO3S and a molecular weight of 358.85 g/mol. Its IUPAC name is 5-chloro-2,8-dimethoxy-10-sulfanyloxy-11H-benzo[b]fluorene.
| Compound Name | 5-chloro-2,8-dimethoxy-10-sulfanyloxy-11H-benzo[b]fluorene |
|---|---|
| PubChem CID | 142087805 |
| Molecular Formula | C19H15ClO3S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 5-chloro-2,8-dimethoxy-10-sulfanyloxy-11H-benzo[b]fluorene |
| SMILES | COc1ccc2c(c1)Cc1c-2c(Cl)c2ccc(OC)cc2c1OS |
| InChI | InChI=1S/C19H15ClO3S/c1-21-11-3-5-13-10(7-11)8-16-17(13)18(20)14-6-4-12(22-2)9-15(14)19(16)23-24/h3-7,9,24H,8H2,1-2H3 |
| InChIKey | UBMPEPKMQKRLPW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|