C11H8OS3 — CID 22353901
6-methoxy-4H-indeno[1,2-c]dithiole-3-thione (PubChem CID 22353901) has the molecular formula C11H8OS3 and a molecular weight of 252.38 g/mol. Its IUPAC name is 6-methoxy-4H-indeno[1,2-c]dithiole-3-thione.
| Compound Name | 6-methoxy-4H-indeno[1,2-c]dithiole-3-thione |
|---|---|
| PubChem CID | 22353901 |
| Molecular Formula | C11H8OS3 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 6-methoxy-4H-indeno[1,2-c]dithiole-3-thione |
| SMILES | COc1ccc2c(c1)Cc1c-2ssc1=S |
| InChI | InChI=1S/C11H8OS3/c1-12-7-2-3-8-6(4-7)5-9-10(8)14-15-11(9)13/h2-4H,5H2,1H3 |
| InChIKey | ICSLZZGIQGGIQI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|