C11H9NOS — CID 172548294
6-methoxy-4H-indeno[2,1-d][1,3]thiazole (PubChem CID 172548294) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is 6-methoxy-4H-indeno[2,1-d][1,3]thiazole.
| Compound Name | 6-methoxy-4H-indeno[2,1-d][1,3]thiazole |
|---|---|
| PubChem CID | 172548294 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 6-methoxy-4H-indeno[2,1-d][1,3]thiazole |
| SMILES | COc1ccc2c(c1)Cc1ncsc1-2 |
| InChI | InChI=1S/C11H9NOS/c1-13-8-2-3-9-7(4-8)5-10-11(9)14-6-12-10/h2-4,6H,5H2,1H3 |
| InChIKey | OEAOEZPTXGCSBE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |