C15H13Cl2O2Zr- — CID 173247087
dichlorozirconium;2,7-dimethoxy-1,9-dihydrofluoren-1-ide (PubChem CID 173247087) has the molecular formula C15H13Cl2O2Zr- and a molecular weight of 387.40 g/mol. Its IUPAC name is dichlorozirconium;2,7-dimethoxy-1,9-dihydrofluoren-1-ide.
| Compound Name | dichlorozirconium;2,7-dimethoxy-1,9-dihydrofluoren-1-ide |
|---|---|
| PubChem CID | 173247087 |
| Molecular Formula | C15H13Cl2O2Zr- |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | dichlorozirconium;2,7-dimethoxy-1,9-dihydrofluoren-1-ide |
| SMILES | COc1[c-]c2c(cc1)-c1ccc(OC)cc1C2.Cl[Zr]Cl |
| InChI | InChI=1S/C15H13O2.2ClH.Zr/c1-16-12-3-5-14-10(8-12)7-11-9-13(17-2)4-6-15(11)14;;;/h3-6,8H,7H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | GZNJEZJOFQWARN-UHFFFAOYSA-L |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|