C17H17NO — CID 142095500
(E)-N-methyl-2,3-diphenylbut-2-enamide (PubChem CID 142095500) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (E)-N-methyl-2,3-diphenylbut-2-enamide.
| Compound Name | (E)-N-methyl-2,3-diphenylbut-2-enamide |
|---|---|
| PubChem CID | 142095500 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (E)-N-methyl-2,3-diphenylbut-2-enamide |
| SMILES | CNC(=O)/C(=C(\C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO/c1-13(14-9-5-3-6-10-14)16(17(19)18-2)15-11-7-4-8-12-15/h3-12H,1-2H3,(H,18,19)/b16-13+ |
| InChIKey | BGDDMHBEURLAOJ-DTQAZKPQSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|