C22H18O2 — CID 14547201
(E)-1-(4-hydroxyphenyl)-2,3-diphenylbut-2-en-1-one (PubChem CID 14547201) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is (E)-1-(4-hydroxyphenyl)-2,3-diphenylbut-2-en-1-one.
| Compound Name | (E)-1-(4-hydroxyphenyl)-2,3-diphenylbut-2-en-1-one |
|---|---|
| PubChem CID | 14547201 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (E)-1-(4-hydroxyphenyl)-2,3-diphenylbut-2-en-1-one |
| SMILES | C/C(=C(\C(=O)c1ccc(O)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18O2/c1-16(17-8-4-2-5-9-17)21(18-10-6-3-7-11-18)22(24)19-12-14-20(23)15-13-19/h2-15,23H,1H3/b21-16+ |
| InChIKey | UMBKOVUSSJLOMU-LTGZKZEYSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|