About (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid
(E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid (PubChem CID 162065004) has the molecular formula C20H20O6
and a molecular weight of 356.37 g/mol. Its IUPAC name is (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid.
Molecular Properties
| Compound Name | (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid |
| PubChem CID | 162065004 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid |
| SMILES | C/C(O)=C(/C(=O)O)c1ccccc1.C/C=C(/C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/2C10H10O3/c1-7(11)9(10(12)13)8-5-3-2-4-6-8;1-2-9(10(12)13)7-3-5-8(11)6-4-7/h2*2-6,11H,1H3,(H,12,13)/b9-7-;9-2+ |
| InChIKey | ZAIOXHYVYATWOD-XUEDAZQPSA-N |
| XLogP | 3.94 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid?
The IUPAC name of (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid (CID 162065004) is (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid.
What is the SMILES notation for (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid?
The canonical SMILES for (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid is C/C(O)=C(/C(=O)O)c1ccccc1.C/C=C(/C(=O)O)c1ccc(O)cc1.
What is the InChIKey of (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid?
The InChIKey is ZAIOXHYVYATWOD-XUEDAZQPSA-N. The full InChI is InChI=1S/2C10H10O3/c1-7(11)9(10(12)13)8-5-3-2-4-6-8;1-2-9(10(12)13)7-3-5-8(11)6-4-7/h2*2-6,11H,1H3,(H,12,13)/b9-7-;9-2+.
What are the key properties of (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid?
(E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid has a molecular weight of 356.37 g/mol, XLogP of 3.94, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(4-hydroxyphenyl)but-2-enoic acid;(Z)-3-hydroxy-2-phenylbut-2-enoic acid is sourced from PubChem (CID 162065004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).