C14H28N2 — CID 142099632
ethane;N,N,N'-trimethyl-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine (PubChem CID 142099632) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;N,N,N'-trimethyl-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine.
| Compound Name | ethane;N,N,N'-trimethyl-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 142099632 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;N,N,N'-trimethyl-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(C)/C=C\C(=C)N(C)CCN(C)C.CC |
| InChI | InChI=1S/C12H22N2.C2H6/c1-11(2)7-8-12(3)14(6)10-9-13(4)5;1-2/h7-8H,1,3,9-10H2,2,4-6H3;1-2H3/b8-7-; |
| InChIKey | PRSYRQRIECEFFQ-CFYXSCKTSA-N |
| XLogP | 3.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|