C9H21N2O6P — CID 142100445
ethane;2-[hydroxy-[2-[[hydroxy(methyl)phosphoryl]methylamino]acetyl]amino]propanoic acid (PubChem CID 142100445) has the molecular formula C9H21N2O6P and a molecular weight of 284.25 g/mol. Its IUPAC name is ethane;2-[hydroxy-[2-[[hydroxy(methyl)phosphoryl]methylamino]acetyl]amino]propanoic acid.
| Compound Name | ethane;2-[hydroxy-[2-[[hydroxy(methyl)phosphoryl]methylamino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142100445 |
| Molecular Formula | C9H21N2O6P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | ethane;2-[hydroxy-[2-[[hydroxy(methyl)phosphoryl]methylamino]acetyl]amino]propanoic acid |
| SMILES | CC.CC(C(=O)O)N(O)C(=O)CNCP(C)(=O)O |
| InChI | InChI=1S/C7H15N2O6P.C2H6/c1-5(7(11)12)9(13)6(10)3-8-4-16(2,14)15;1-2/h5,8,13H,3-4H2,1-2H3,(H,11,12)(H,14,15);1-2H3 |
| InChIKey | HECRQTPASQVHKG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|