C19H22O2Rh — CID 142112488
2-bicyclo[2.2.1]hept-5-enylmethyl (E)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enoate;rhodium (PubChem CID 142112488) has the molecular formula C19H22O2Rh and a molecular weight of 385.29 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl (E)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enoate;rhodium.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl (E)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enoate;rhodium |
|---|---|
| PubChem CID | 142112488 |
| Molecular Formula | C19H22O2Rh |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl (E)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enoate;rhodium |
| SMILES | CC1=CC=C(/C=C/C(=O)OCC2CC3C=CC2C3)C=CC1.[Rh] |
| InChI | InChI=1S/C19H22O2.Rh/c1-14-3-2-4-15(6-5-14)8-10-19(20)21-13-18-12-16-7-9-17(18)11-16;/h2,4-10,16-18H,3,11-13H2,1H3;/b10-8+; |
| InChIKey | RNJOLGZQFGFZLT-VRTOBVRTSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|