About (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine
(NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine (PubChem CID 142113819) has the molecular formula C21H25NO
and a molecular weight of 307.44 g/mol. Its IUPAC name is (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine |
| PubChem CID | 142113819 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine |
| SMILES | CCC(C)/C=C(C(=N\O)/c1ccc(C)cc1)\c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO/c1-5-15(2)14-20(18-10-6-16(3)7-11-18)21(22-23)19-12-8-17(4)9-13-19/h6-15,23H,5H2,1-4H3/b20-14+,22-21- |
| InChIKey | WCODRIUQIVBVNH-NJPMQTPOSA-N |
| XLogP | 5.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine (CID 142113819) is (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine is CCC(C)/C=C(C(=N\O)/c1ccc(C)cc1)\c1ccc(C)cc1.
What is the InChIKey of (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine?
The InChIKey is WCODRIUQIVBVNH-NJPMQTPOSA-N. The full InChI is InChI=1S/C21H25NO/c1-5-15(2)14-20(18-10-6-16(3)7-11-18)21(22-23)19-12-8-17(4)9-13-19/h6-15,23H,5H2,1-4H3/b20-14+,22-21-.
What are the key properties of (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine?
(NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine has a molecular weight of 307.44 g/mol, XLogP of 5.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine is sourced from PubChem (CID 142113819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).