C21H25NO — CID 142113819
(NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine (PubChem CID 142113819) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 142113819 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (NZ)-N-[(E)-4-methyl-1,2-bis(4-methylphenyl)hex-2-enylidene]hydroxylamine |
| SMILES | CCC(C)/C=C(C(=N\O)/c1ccc(C)cc1)\c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO/c1-5-15(2)14-20(18-10-6-16(3)7-11-18)21(22-23)19-12-8-17(4)9-13-19/h6-15,23H,5H2,1-4H3/b20-14+,22-21- |
| InChIKey | WCODRIUQIVBVNH-NJPMQTPOSA-N |
| XLogP | 5.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|