C10H18N2 — CID 142114351
(E)-N'-methyl-2-[(2Z)-penta-2,4-dienyl]but-2-ene-1,4-diamine (PubChem CID 142114351) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (E)-N'-methyl-2-[(2Z)-penta-2,4-dienyl]but-2-ene-1,4-diamine.
| Compound Name | (E)-N'-methyl-2-[(2Z)-penta-2,4-dienyl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 142114351 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (E)-N'-methyl-2-[(2Z)-penta-2,4-dienyl]but-2-ene-1,4-diamine |
| SMILES | C=C/C=C\C/C(=C\CNC)CN |
| InChI | InChI=1S/C10H18N2/c1-3-4-5-6-10(9-11)7-8-12-2/h3-5,7,12H,1,6,8-9,11H2,2H3/b5-4-,10-7+ |
| InChIKey | WCVWWHPAAAYVCI-DOIONKORSA-N |
| XLogP | 1.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|