C20H27N7O2S — CID 142117976
[3-[6-amino-8-[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]ethylamino]purin-9-yl]cyclopentyl]methanol (PubChem CID 142117976) has the molecular formula C20H27N7O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is [3-[6-amino-8-[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]ethylamino]purin-9-yl]cyclopentyl]methanol.
| Compound Name | [3-[6-amino-8-[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]ethylamino]purin-9-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 142117976 |
| Molecular Formula | C20H27N7O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [3-[6-amino-8-[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]ethylamino]purin-9-yl]cyclopentyl]methanol |
| SMILES | C=S(N)(=O)c1ccc(CCNc2nc3c(N)ncnc3n2C2CCC(CO)C2)cc1 |
| InChI | InChI=1S/C20H27N7O2S/c1-30(22,29)16-6-3-13(4-7-16)8-9-23-20-26-17-18(21)24-12-25-19(17)27(20)15-5-2-14(10-15)11-28/h3-4,6-7,12,14-15,28H,1-2,5,8-11H2,(H2,22,29)(H,23,26)(H2,21,24,25) |
| InChIKey | LWBYLYGUEDBYRH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|