C20H28N6O2 — CID 142117944
methanamine;[6-[8-(2-phenylethylamino)purin-9-yl]oxan-3-yl]methanol (PubChem CID 142117944) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is methanamine;[6-[8-(2-phenylethylamino)purin-9-yl]oxan-3-yl]methanol.
| Compound Name | methanamine;[6-[8-(2-phenylethylamino)purin-9-yl]oxan-3-yl]methanol |
|---|---|
| PubChem CID | 142117944 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | methanamine;[6-[8-(2-phenylethylamino)purin-9-yl]oxan-3-yl]methanol |
| SMILES | CN.OCC1CCC(n2c(NCCc3ccccc3)nc3cncnc32)OC1 |
| InChI | InChI=1S/C19H23N5O2.CH5N/c25-11-15-6-7-17(26-12-15)24-18-16(10-20-13-22-18)23-19(24)21-9-8-14-4-2-1-3-5-14;1-2/h1-5,10,13,15,17,25H,6-9,11-12H2,(H,21,23);2H2,1H3 |
| InChIKey | GZEPMAJDOQSPPL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |