C14H16N6O — CID 54452336
2-[[8-(benzylamino)purin-9-yl]amino]ethanol (PubChem CID 54452336) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[[8-(benzylamino)purin-9-yl]amino]ethanol.
| Compound Name | 2-[[8-(benzylamino)purin-9-yl]amino]ethanol |
|---|---|
| PubChem CID | 54452336 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[[8-(benzylamino)purin-9-yl]amino]ethanol |
| SMILES | OCCNn1c(NCc2ccccc2)nc2cncnc21 |
| InChI | InChI=1S/C14H16N6O/c21-7-6-18-20-13-12(9-15-10-17-13)19-14(20)16-8-11-4-2-1-3-5-11/h1-5,9-10,18,21H,6-8H2,(H,16,19) |
| InChIKey | WVULGBSLWRSOMT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |