potassium 2-aminopyridine-3-thiolate

C5H5KN2S — CID 142119104

IUPACpotassium 2-aminopyridine-3-thiolate
SMILESNc1ncccc1[S-].[K+]
InChIInChI=1S/C5H6N2S.K/c6-5-4(8)2-1-3-7-5;/h1-3,8H,(H2,6,7);/q;+1/p-1
InChIKeyLGHKCPOMMQVONO-UHFFFAOYSA-M
MW164.27 g/mol
LogP-2.43
Rot. Bonds

About potassium 2-aminopyridine-3-thiolate

potassium 2-aminopyridine-3-thiolate (PubChem CID 142119104) has the molecular formula C5H5KN2S and a molecular weight of 164.27 g/mol. Its IUPAC name is potassium 2-aminopyridine-3-thiolate.

Molecular Properties

Compound Namepotassium 2-aminopyridine-3-thiolate
PubChem CID142119104
Molecular FormulaC5H5KN2S
Molecular Weight164.27 g/mol
Exact Mass163.98
IUPAC Namepotassium 2-aminopyridine-3-thiolate
SMILESNc1ncccc1[S-].[K+]
InChIInChI=1S/C5H6N2S.K/c6-5-4(8)2-1-3-7-5;/h1-3,8H,(H2,6,7);/q;+1/p-1
InChIKeyLGHKCPOMMQVONO-UHFFFAOYSA-M
XLogP-2.43
TPSA38.91 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.27
LogP ≤ 5-2.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_1', 'substructure': 'N/A'}

Analyze potassium 2-aminopyridine-3-thiolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-aminopyridine-3-thiolate?
The IUPAC name of potassium 2-aminopyridine-3-thiolate (CID 142119104) is potassium 2-aminopyridine-3-thiolate.
What is the SMILES notation for potassium 2-aminopyridine-3-thiolate?
The canonical SMILES for potassium 2-aminopyridine-3-thiolate is Nc1ncccc1[S-].[K+].
What is the InChIKey of potassium 2-aminopyridine-3-thiolate?
The InChIKey is LGHKCPOMMQVONO-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N2S.K/c6-5-4(8)2-1-3-7-5;/h1-3,8H,(H2,6,7);/q;+1/p-1.
What are the key properties of potassium 2-aminopyridine-3-thiolate?
potassium 2-aminopyridine-3-thiolate has a molecular weight of 164.27 g/mol, XLogP of -2.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-aminopyridine-3-thiolate is sourced from PubChem (CID 142119104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).