About (2-amino-3-pyridinyl) thiohypofluorite
(2-amino-3-pyridinyl) thiohypofluorite (PubChem CID 143924195) has the molecular formula C5H5FN2S
and a molecular weight of 144.17 g/mol. Its IUPAC name is (2-amino-3-pyridinyl) thiohypofluorite.
Molecular Properties
| Compound Name | (2-amino-3-pyridinyl) thiohypofluorite |
| PubChem CID | 143924195 |
| Molecular Formula | C5H5FN2S |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | (2-amino-3-pyridinyl) thiohypofluorite |
| SMILES | Nc1ncccc1SF |
| InChI | InChI=1S/C5H5FN2S/c6-9-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8) |
| InChIKey | USWGUWQFULLSQH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-3-pyridinyl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-pyridinyl) thiohypofluorite?
The IUPAC name of (2-amino-3-pyridinyl) thiohypofluorite (CID 143924195) is (2-amino-3-pyridinyl) thiohypofluorite.
What is the SMILES notation for (2-amino-3-pyridinyl) thiohypofluorite?
The canonical SMILES for (2-amino-3-pyridinyl) thiohypofluorite is Nc1ncccc1SF.
What is the InChIKey of (2-amino-3-pyridinyl) thiohypofluorite?
The InChIKey is USWGUWQFULLSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2S/c6-9-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8).
What are the key properties of (2-amino-3-pyridinyl) thiohypofluorite?
(2-amino-3-pyridinyl) thiohypofluorite has a molecular weight of 144.17 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-pyridinyl) thiohypofluorite is sourced from PubChem (CID 143924195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).