C22H32ClNO2 — CID 142119200
tert-butyl 4-[2-(4-chloro-2-ethenylphenyl)butyl]piperidine-1-carboxylate (PubChem CID 142119200) has the molecular formula C22H32ClNO2 and a molecular weight of 377.96 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-chloro-2-ethenylphenyl)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-chloro-2-ethenylphenyl)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142119200 |
| Molecular Formula | C22H32ClNO2 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | tert-butyl 4-[2-(4-chloro-2-ethenylphenyl)butyl]piperidine-1-carboxylate |
| SMILES | C=Cc1cc(Cl)ccc1C(CC)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H32ClNO2/c1-6-17(20-9-8-19(23)15-18(20)7-2)14-16-10-12-24(13-11-16)21(25)26-22(3,4)5/h7-9,15-17H,2,6,10-14H2,1,3-5H3 |
| InChIKey | ZKIFYVMRVSPXRC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |