C19H38N2 — CID 142121541
ethane;N'-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-N,N-dipropylbutanimidamide (PubChem CID 142121541) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is ethane;N'-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-N,N-dipropylbutanimidamide.
| Compound Name | ethane;N'-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-N,N-dipropylbutanimidamide |
|---|---|
| PubChem CID | 142121541 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | ethane;N'-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-N,N-dipropylbutanimidamide |
| SMILES | C=C/C(=C\N=C(/C(C)CC)N(CCC)CCC)CC.CC |
| InChI | InChI=1S/C17H32N2.C2H6/c1-7-12-19(13-8-2)17(15(6)9-3)18-14-16(10-4)11-5;1-2/h10,14-15H,4,7-9,11-13H2,1-3,5-6H3;1-2H3/b16-14+,18-17+; |
| InChIKey | WUGGKOCVOGJXKL-VDWRAFQUSA-N |
| XLogP | 6.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|